C28H19N3O6 — CID 139237748
3-[(E)-(4,9-dimethoxy-5-oxofuro[3,2-g]chromen-6-yl)methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 139237748) has the molecular formula C28H19N3O6 and a molecular weight of 493.48 g/mol. Its IUPAC name is 3-[(E)-(4,9-dimethoxy-5-oxofuro[3,2-g]chromen-6-yl)methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[(E)-(4,9-dimethoxy-5-oxofuro[3,2-g]chromen-6-yl)methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 139237748 |
| Molecular Formula | C28H19N3O6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[(E)-(4,9-dimethoxy-5-oxofuro[3,2-g]chromen-6-yl)methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1c2occc2c(OC)c2c(=O)c(/C=N/n3c(-c4ccccc4)nc4ccccc4c3=O)coc12 |
| InChI | InChI=1S/C28H19N3O6/c1-34-23-19-12-13-36-24(19)26(35-2)25-21(23)22(32)17(15-37-25)14-29-31-27(16-8-4-3-5-9-16)30-20-11-7-6-10-18(20)28(31)33/h3-15H,1-2H3/b29-14+ |
| InChIKey | TUQDQZRSXJUGLY-IPPBACCNSA-N |
| XLogP | 4.82 |
| TPSA | 109.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|