C33H40Cl2N2P2Ru — CID 139238369
dichlororuthenium;3-diphenylphosphanylpropyl(diphenyl)phosphane;piperidin-2-ylmethanamine (PubChem CID 139238369) has the molecular formula C33H40Cl2N2P2Ru and a molecular weight of 698.62 g/mol. Its IUPAC name is dichlororuthenium;3-diphenylphosphanylpropyl(diphenyl)phosphane;piperidin-2-ylmethanamine.
| Compound Name | dichlororuthenium;3-diphenylphosphanylpropyl(diphenyl)phosphane;piperidin-2-ylmethanamine |
|---|---|
| PubChem CID | 139238369 |
| Molecular Formula | C33H40Cl2N2P2Ru |
| Molecular Weight | 698.62 g/mol |
| Exact Mass | 698.11 |
| IUPAC Name | dichlororuthenium;3-diphenylphosphanylpropyl(diphenyl)phosphane;piperidin-2-ylmethanamine |
| SMILES | Cl[Ru]Cl.NCC1CCCCN1.c1ccc(P(CCCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26P2.C6H14N2.2ClH.Ru/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;7-5-6-3-1-2-4-8-6;;;/h1-12,14-21H,13,22-23H2;6,8H,1-5,7H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | BHJUJLXFOMTHJD-UHFFFAOYSA-L |
| XLogP | 7.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|