C18H18BrFeN — CID 139238388
4-bromo-N-(1-cyclopenta-1,3-dien-1-ylethyl)aniline;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139238388) has the molecular formula C18H18BrFeN and a molecular weight of 384.10 g/mol. Its IUPAC name is 4-bromo-N-(1-cyclopenta-1,3-dien-1-ylethyl)aniline;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 4-bromo-N-(1-cyclopenta-1,3-dien-1-ylethyl)aniline;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139238388 |
| Molecular Formula | C18H18BrFeN |
| Molecular Weight | 384.10 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 4-bromo-N-(1-cyclopenta-1,3-dien-1-ylethyl)aniline;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(Nc1ccc(Br)cc1)c1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C13H13BrN.C5H5.Fe/c1-10(11-4-2-3-5-11)15-13-8-6-12(14)7-9-13;1-2-4-5-3-1;/h2-10,15H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | GEEUUARKFPSISA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.10 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|