C16H16FeN2S — CID 139238403
cyclopenta-1,3-diene;2-(1-cyclopenta-1,3-dien-1-ylethylsulfanyl)pyrimidine;iron(2+) (PubChem CID 139238403) has the molecular formula C16H16FeN2S and a molecular weight of 324.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-(1-cyclopenta-1,3-dien-1-ylethylsulfanyl)pyrimidine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-(1-cyclopenta-1,3-dien-1-ylethylsulfanyl)pyrimidine;iron(2+) |
|---|---|
| PubChem CID | 139238403 |
| Molecular Formula | C16H16FeN2S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | cyclopenta-1,3-diene;2-(1-cyclopenta-1,3-dien-1-ylethylsulfanyl)pyrimidine;iron(2+) |
| SMILES | CC(Sc1ncccn1)c1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C11H11N2S.C5H5.Fe/c1-9(10-5-2-3-6-10)14-11-12-7-4-8-13-11;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | XPUKBNQJPGUAAK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|