C12H11ClN2O — CID 139238556
1-(4-chlorophenyl)-3-cyclopenta-1,4-dien-1-ylurea (PubChem CID 139238556) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-cyclopenta-1,4-dien-1-ylurea.
| Compound Name | 1-(4-chlorophenyl)-3-cyclopenta-1,4-dien-1-ylurea |
|---|---|
| PubChem CID | 139238556 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-(4-chlorophenyl)-3-cyclopenta-1,4-dien-1-ylurea |
| SMILES | O=C(NC1=CCC=C1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN2O/c13-9-5-7-11(8-6-9)15-12(16)14-10-3-1-2-4-10/h1,3-8H,2H2,(H2,14,15,16) |
| InChIKey | BUUSPDCYIYCZSC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |