C21H25NO5 — CID 139238735
[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanol (PubChem CID 139238735) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanol.
| Compound Name | [[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanol |
|---|---|
| PubChem CID | 139238735 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanol |
| SMILES | CC1(C)O[C@H]2O[C@H](CNC(O)=C3C=CC=C3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C21H25NO5/c1-21(2)26-18-17(24-13-14-8-4-3-5-9-14)16(25-20(18)27-21)12-22-19(23)15-10-6-7-11-15/h3-11,16-18,20,22-23H,12-13H2,1-2H3/t16-,17+,18-,20-/m1/s1 |
| InChIKey | DFFMYCZTUVFXIC-AJYBTWMASA-N |
| XLogP | 2.93 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|