C15H21NO4 — CID 139238740
[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanamine (PubChem CID 139238740) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanamine.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanamine |
|---|---|
| PubChem CID | 139238740 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanamine |
| SMILES | CC1(C)O[C@H]2O[C@H](CN)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C15H21NO4/c1-15(2)19-13-12(11(8-16)18-14(13)20-15)17-9-10-6-4-3-5-7-10/h3-7,11-14H,8-9,16H2,1-2H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | UKVOCJCVONOOLC-XJFOESAGSA-N |
| XLogP | 1.41 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |