C11H16O2 — CID 139238748
1-butyl-1,4,5,6-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 139238748) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-butyl-1,4,5,6-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 1-butyl-1,4,5,6-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 139238748 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-butyl-1,4,5,6-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | CCCCC1OC(=O)C2=C1CCC2 |
| InChI | InChI=1S/C11H16O2/c1-2-3-7-10-8-5-4-6-9(8)11(12)13-10/h10H,2-7H2,1H3 |
| InChIKey | OQMAUGRURBJVEM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |