C25H29INOSi — CID 139239056
N-Methyl-N-(2-methyldiphenylsiloxyethyl)-1,2,3,4-tetrahydroisoquinolinium iodide (PubChem CID 139239056) has the molecular formula C25H29INOSi and a molecular weight of 514.50 g/mol.
| Compound Name | N-Methyl-N-(2-methyldiphenylsiloxyethyl)-1,2,3,4-tetrahydroisoquinolinium iodide |
|---|---|
| PubChem CID | 139239056 |
| Molecular Formula | C25H29INOSi |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | — |
| SMILES | CC(C[N+]1(C)CCc2ccccc2C1)O[Si](c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C25H29NOSi.HI/c1-21(19-26(2)18-17-22-11-9-10-12-23(22)20-26)27-28(24-13-5-3-6-14-24)25-15-7-4-8-16-25;/h3-16,21H,17-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BMQAXVSGGFSXIH-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|