About (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one
(1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one (PubChem CID 139239294) has the molecular formula C19H14O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one.
Molecular Properties
| Compound Name | (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one |
| PubChem CID | 139239294 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one |
| SMILES | O=C1O/C(=C/c2ccccc2)C2=C1CCc1ccccc12 |
| InChI | InChI=1S/C19H14O2/c20-19-16-11-10-14-8-4-5-9-15(14)18(16)17(21-19)12-13-6-2-1-3-7-13/h1-9,12H,10-11H2/b17-12+ |
| InChIKey | QZGJBYJQNPSTLG-SFQUDFHCSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one?
The IUPAC name of (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one (CID 139239294) is (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one.
What is the SMILES notation for (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one?
The canonical SMILES for (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one is O=C1O/C(=C/c2ccccc2)C2=C1CCc1ccccc12.
What is the InChIKey of (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one?
The InChIKey is QZGJBYJQNPSTLG-SFQUDFHCSA-N. The full InChI is InChI=1S/C19H14O2/c20-19-16-11-10-14-8-4-5-9-15(14)18(16)17(21-19)12-13-6-2-1-3-7-13/h1-9,12H,10-11H2/b17-12+.
What are the key properties of (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one?
(1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one has a molecular weight of 274.32 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-benzylidene-4,5-dihydrobenzo[e][2]benzofuran-3-one is sourced from PubChem (CID 139239294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).