C24H42N2S4Si2 — CID 139239301
trans-(1R,2R)-1-N,2-N-bis[(3-methylsulfanyl-5-trimethylsilylthiophen-2-yl)methyl]cyclohexane-1,2-diamine (PubChem CID 139239301) has the molecular formula C24H42N2S4Si2 and a molecular weight of 543.05 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis[(3-methylsulfanyl-5-trimethylsilylthiophen-2-yl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis[(3-methylsulfanyl-5-trimethylsilylthiophen-2-yl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 139239301 |
| Molecular Formula | C24H42N2S4Si2 |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis[(3-methylsulfanyl-5-trimethylsilylthiophen-2-yl)methyl]cyclohexane-1,2-diamine |
| SMILES | CSc1cc([Si](C)(C)C)sc1CN[C@@H]1CCCC[C@H]1NCc1sc([Si](C)(C)C)cc1SC |
| InChI | InChI=1S/C24H42N2S4Si2/c1-27-19-13-23(31(3,4)5)29-21(19)15-25-17-11-9-10-12-18(17)26-16-22-20(28-2)14-24(30-22)32(6,7)8/h13-14,17-18,25-26H,9-12,15-16H2,1-8H3/t17-,18-/m1/s1 |
| InChIKey | IPXRBRGDKJQREE-QZTJIDSGSA-N |
| XLogP | 6.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|