C27H26N4O2 — CID 139239396
4-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethyl]morpholine (PubChem CID 139239396) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethyl]morpholine.
| Compound Name | 4-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 139239396 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 4-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethyl]morpholine |
| SMILES | c1ccc(-c2cc(-c3ccc(OCCN4CCOCC4)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C27H26N4O2/c1-3-11-28-24(5-1)26-19-22(20-27(30-26)25-6-2-4-12-29-25)21-7-9-23(10-8-21)33-18-15-31-13-16-32-17-14-31/h1-12,19-20H,13-18H2 |
| InChIKey | ZHFJGYBGPJLSOA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |