C16H10ClN3O3S — CID 139239790
5-[(E)-3-(2-chloroquinolin-3-yl)prop-2-enoyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 139239790) has the molecular formula C16H10ClN3O3S and a molecular weight of 359.79 g/mol. Its IUPAC name is 5-[(E)-3-(2-chloroquinolin-3-yl)prop-2-enoyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(E)-3-(2-chloroquinolin-3-yl)prop-2-enoyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 139239790 |
| Molecular Formula | C16H10ClN3O3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 5-[(E)-3-(2-chloroquinolin-3-yl)prop-2-enoyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C(/C=C/c1cc2ccccc2nc1Cl)C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C16H10ClN3O3S/c17-13-9(7-8-3-1-2-4-10(8)18-13)5-6-11(21)12-14(22)19-16(24)20-15(12)23/h1-7,12H,(H2,19,20,22,23,24)/b6-5+ |
| InChIKey | OQUGXSGXJBODHP-AATRIKPKSA-N |
| XLogP | 1.62 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|