About (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium
(N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium (PubChem CID 139239963) has the molecular formula C9H19LiN2Se
and a molecular weight of 241.17 g/mol. Its IUPAC name is (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium.
Molecular Properties
| Compound Name | (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium |
| PubChem CID | 139239963 |
| Molecular Formula | C9H19LiN2Se |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium |
| SMILES | [Li][Se]/C(=N\C(C)(C)C)N(CC)CC |
| InChI | InChI=1S/C9H20N2Se.Li/c1-6-11(7-2)8(12)10-9(3,4)5;/h6-7H2,1-5H3,(H,10,12);/q;+1/p-1 |
| InChIKey | SKYBLEMUTBNBPK-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium?
The IUPAC name of (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium (CID 139239963) is (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium.
What is the SMILES notation for (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium?
The canonical SMILES for (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium is [Li][Se]/C(=N\C(C)(C)C)N(CC)CC.
What is the InChIKey of (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium?
The InChIKey is SKYBLEMUTBNBPK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20N2Se.Li/c1-6-11(7-2)8(12)10-9(3,4)5;/h6-7H2,1-5H3,(H,10,12);/q;+1/p-1.
What are the key properties of (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium?
(N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium has a molecular weight of 241.17 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (N'-tert-butyl-N,N-diethylcarbamimidoyl)selanyllithium is sourced from PubChem (CID 139239963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).