C17H17FeN — CID 139240111
cyclopenta-1,3-diene;4-cyclopenta-2,4-dien-1-ylidene-3-methylcyclohexa-1,5-dien-1-amine;iron(2+) (PubChem CID 139240111) has the molecular formula C17H17FeN and a molecular weight of 291.18 g/mol. Its IUPAC name is cyclopenta-1,3-diene;4-cyclopenta-2,4-dien-1-ylidene-3-methylcyclohexa-1,5-dien-1-amine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;4-cyclopenta-2,4-dien-1-ylidene-3-methylcyclohexa-1,5-dien-1-amine;iron(2+) |
|---|---|
| PubChem CID | 139240111 |
| Molecular Formula | C17H17FeN |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | cyclopenta-1,3-diene;4-cyclopenta-2,4-dien-1-ylidene-3-methylcyclohexa-1,5-dien-1-amine;iron(2+) |
| SMILES | C[C-]1C=C(N)C=CC1=C1C=CC=C1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C12H12N.C5H5.Fe/c1-9-8-11(13)6-7-12(9)10-4-2-3-5-10;1-2-4-5-3-1;/h2-8H,13H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | UAZVNHWAEJGCKV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|