About tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+)
tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) (PubChem CID 139240159) has the molecular formula C33H23N2O9Sm
and a molecular weight of 741.91 g/mol. Its IUPAC name is tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+).
Molecular Properties
| Compound Name | tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) |
| PubChem CID | 139240159 |
| Molecular Formula | C33H23N2O9Sm |
| Molecular Weight | 741.91 g/mol |
| Exact Mass | 743.06 |
| IUPAC Name | tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) |
| SMILES | O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Sm+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C7H6O3.Sm/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*8-6-4-2-1-3-5(6)7(9)10;/h1-8H;3*1-4,8H,(H,9,10);/q;;;;+3/p-3 |
| InChIKey | DWCNMABBCXKOEB-UHFFFAOYSA-K |
| XLogP | 4.16 |
| TPSA | 206.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 741.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+)?
The IUPAC name of tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) (CID 139240159) is tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+).
What is the SMILES notation for tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+)?
The canonical SMILES for tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) is O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Sm+3].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+)?
The InChIKey is DWCNMABBCXKOEB-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H8N2.3C7H6O3.Sm/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*8-6-4-2-1-3-5(6)7(9)10;/h1-8H;3*1-4,8H,(H,9,10);/q;;;;+3/p-3.
What are the key properties of tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+)?
tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) has a molecular weight of 741.91 g/mol, XLogP of 4.16, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-carboxyphenolate);1,10-phenanthroline;samarium(3+) is sourced from PubChem (CID 139240159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).