C15H17N5 — CID 139240433
4-methyl-N,N-bis(pyrazol-1-ylmethyl)aniline (PubChem CID 139240433) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-methyl-N,N-bis(pyrazol-1-ylmethyl)aniline.
| Compound Name | 4-methyl-N,N-bis(pyrazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 139240433 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-methyl-N,N-bis(pyrazol-1-ylmethyl)aniline |
| SMILES | Cc1ccc(N(Cn2cccn2)Cn2cccn2)cc1 |
| InChI | InChI=1S/C15H17N5/c1-14-4-6-15(7-5-14)18(12-19-10-2-8-16-19)13-20-11-3-9-17-20/h2-11H,12-13H2,1H3 |
| InChIKey | LFMMJJNBNBHXQY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|