C16H19N5 — CID 139240435
3,5-dimethyl-N,N-bis(pyrazol-1-ylmethyl)aniline (PubChem CID 139240435) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3,5-dimethyl-N,N-bis(pyrazol-1-ylmethyl)aniline.
| Compound Name | 3,5-dimethyl-N,N-bis(pyrazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 139240435 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3,5-dimethyl-N,N-bis(pyrazol-1-ylmethyl)aniline |
| SMILES | Cc1cc(C)cc(N(Cn2cccn2)Cn2cccn2)c1 |
| InChI | InChI=1S/C16H19N5/c1-14-9-15(2)11-16(10-14)19(12-20-7-3-5-17-20)13-21-8-4-6-18-21/h3-11H,12-13H2,1-2H3 |
| InChIKey | ZPBGARKLEFJRCZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |