About CID 139241405
CID 139241405 (PubChem CID 139241405) has the molecular formula C30H36Cl2N2RuS
and a molecular weight of 628.68 g/mol.
Molecular Properties
| Compound Name | CID 139241405 |
| PubChem CID | 139241405 |
| Molecular Formula | C30H36Cl2N2RuS |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | — |
| SMILES | CCSc1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26N2.C9H10S.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-3-10-9-7-5-4-6-8(9)2;;;/h9-12H,7-8H2,1-6H3;2,4-7H,3H2,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | HNYSOKUFRMHAGK-UHFFFAOYSA-L |
| XLogP | 8.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 139241405 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139241405?
The IUPAC name of CID 139241405 (CID 139241405) is not available.
What is the SMILES notation for CID 139241405?
The canonical SMILES for CID 139241405 is CCSc1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.
What is the InChIKey of CID 139241405?
The InChIKey is HNYSOKUFRMHAGK-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H26N2.C9H10S.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-3-10-9-7-5-4-6-8(9)2;;;/h9-12H,7-8H2,1-6H3;2,4-7H,3H2,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 139241405?
CID 139241405 has a molecular weight of 628.68 g/mol, XLogP of 8.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139241405 is sourced from PubChem (CID 139241405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).