C20H18O3 — CID 139242349
1,5-bis(4-methoxyphenyl)-3-methylpenta-1,4-diyn-3-ol (PubChem CID 139242349) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-3-methylpenta-1,4-diyn-3-ol.
| Compound Name | 1,5-bis(4-methoxyphenyl)-3-methylpenta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 139242349 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-3-methylpenta-1,4-diyn-3-ol |
| SMILES | COc1ccc(C#CC(C)(O)C#Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H18O3/c1-20(21,14-12-16-4-8-18(22-2)9-5-16)15-13-17-6-10-19(23-3)11-7-17/h4-11,21H,1-3H3 |
| InChIKey | BYYSCNDTCPFXJM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|