About (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid
(5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid (PubChem CID 139242660) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid.
Molecular Properties
| Compound Name | (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid |
| PubChem CID | 139242660 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid |
| SMILES | O=C/C=C1\C=CC=C(C(=O)O)C=C1 |
| InChI | InChI=1S/C10H8O3/c11-7-6-8-2-1-3-9(5-4-8)10(12)13/h1-7H,(H,12,13)/b8-6+ |
| InChIKey | JIHXGXVCOPFIKT-SOFGYWHQSA-N |
| XLogP | 1.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid?
The IUPAC name of (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid (CID 139242660) is (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid.
What is the SMILES notation for (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid?
The canonical SMILES for (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid is O=C/C=C1\C=CC=C(C(=O)O)C=C1.
What is the InChIKey of (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid?
The InChIKey is JIHXGXVCOPFIKT-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H8O3/c11-7-6-8-2-1-3-9(5-4-8)10(12)13/h1-7H,(H,12,13)/b8-6+.
What are the key properties of (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid?
(5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid has a molecular weight of 176.17 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-(2-oxoethylidene)cyclohepta-1,3,6-triene-1-carboxylic acid is sourced from PubChem (CID 139242660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).