About CID 139242697
CID 139242697 (PubChem CID 139242697) has the molecular formula C6H8S
and a molecular weight of 112.20 g/mol.
Molecular Properties
| Compound Name | CID 139242697 |
| PubChem CID | 139242697 |
| Molecular Formula | C6H8S |
| Molecular Weight | 112.20 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | — |
| SMILES | CC1(C)[C]SC=C1 |
| InChI | InChI=1S/C6H8S/c1-6(2)3-4-7-5-6/h3-4H,1-2H3 |
| InChIKey | VAQWZDUVDMHSHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 139242697 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139242697?
The IUPAC name of CID 139242697 (CID 139242697) is not available.
What is the SMILES notation for CID 139242697?
The canonical SMILES for CID 139242697 is CC1(C)[C]SC=C1.
What is the InChIKey of CID 139242697?
The InChIKey is VAQWZDUVDMHSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8S/c1-6(2)3-4-7-5-6/h3-4H,1-2H3.
What are the key properties of CID 139242697?
CID 139242697 has a molecular weight of 112.20 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139242697 is sourced from PubChem (CID 139242697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).