C8H10O2 — CID 139242860
1-(3-hydroxycyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 139242860) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(3-hydroxycyclohexa-1,5-dien-1-yl)ethanone.
| Compound Name | 1-(3-hydroxycyclohexa-1,5-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 139242860 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 1-(3-hydroxycyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC(O)CC=C1 |
| InChI | InChI=1S/C8H10O2/c1-6(9)7-3-2-4-8(10)5-7/h2-3,5,8,10H,4H2,1H3 |
| InChIKey | GMBMRNPFBLUGQB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |