C6HClF8 — CID 139243159
1-chloro-2,3,3,4,4,5,6,6-octafluorocyclohexene (PubChem CID 139243159) has the molecular formula C6HClF8 and a molecular weight of 260.51 g/mol. Its IUPAC name is 1-chloro-2,3,3,4,4,5,6,6-octafluorocyclohexene.
| Compound Name | 1-chloro-2,3,3,4,4,5,6,6-octafluorocyclohexene |
|---|---|
| PubChem CID | 139243159 |
| Molecular Formula | C6HClF8 |
| Molecular Weight | 260.51 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 1-chloro-2,3,3,4,4,5,6,6-octafluorocyclohexene |
| SMILES | FC1=C(Cl)C(F)(F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6HClF8/c7-1-2(8)5(12,13)6(14,15)3(9)4(1,10)11/h3H |
| InChIKey | OWHUGLPDTRUSAO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|