About 1-phenylpyridin-1-ium;trifluoromethanesulfonate
1-phenylpyridin-1-ium;trifluoromethanesulfonate (PubChem CID 139243494) has the molecular formula C12H10F3NO3S
and a molecular weight of 305.28 g/mol. Its IUPAC name is 1-phenylpyridin-1-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-phenylpyridin-1-ium;trifluoromethanesulfonate |
| PubChem CID | 139243494 |
| Molecular Formula | C12H10F3NO3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-phenylpyridin-1-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C11H10N.CHF3O3S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AFGCZOUMMMXAOH-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpyridin-1-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyridin-1-ium;trifluoromethanesulfonate?
The IUPAC name of 1-phenylpyridin-1-ium;trifluoromethanesulfonate (CID 139243494) is 1-phenylpyridin-1-ium;trifluoromethanesulfonate.
What is the SMILES notation for 1-phenylpyridin-1-ium;trifluoromethanesulfonate?
The canonical SMILES for 1-phenylpyridin-1-ium;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.c1ccc(-[n+]2ccccc2)cc1.
What is the InChIKey of 1-phenylpyridin-1-ium;trifluoromethanesulfonate?
The InChIKey is AFGCZOUMMMXAOH-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10N.CHF3O3S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1-phenylpyridin-1-ium;trifluoromethanesulfonate?
1-phenylpyridin-1-ium;trifluoromethanesulfonate has a molecular weight of 305.28 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyridin-1-ium;trifluoromethanesulfonate is sourced from PubChem (CID 139243494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).