1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride

C8H11FN- — CID 139243611

IUPAC1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride
SMILESCN(C)C=C1C=CC=C1.[F-]
InChIInChI=1S/C8H11N.FH/c1-9(2)7-8-5-3-4-6-8;/h3-7H,1-2H3;1H/p-1
InChIKeyYUIHHOHXXXNTSZ-UHFFFAOYSA-M
MW140.18 g/mol
LogP-1.44
Rot. Bonds1

About 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride

1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride (PubChem CID 139243611) has the molecular formula C8H11FN- and a molecular weight of 140.18 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride.

Molecular Properties

Compound Name1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride
PubChem CID139243611
Molecular FormulaC8H11FN-
Molecular Weight140.18 g/mol
Exact Mass140.09
IUPAC Name1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride
SMILESCN(C)C=C1C=CC=C1.[F-]
InChIInChI=1S/C8H11N.FH/c1-9(2)7-8-5-3-4-6-8;/h3-7H,1-2H3;1H/p-1
InChIKeyYUIHHOHXXXNTSZ-UHFFFAOYSA-M
XLogP-1.44
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.18
LogP ≤ 5-1.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride (CID 139243611) is 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride is CN(C)C=C1C=CC=C1.[F-].
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride?
The InChIKey is YUIHHOHXXXNTSZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11N.FH/c1-9(2)7-8-5-3-4-6-8;/h3-7H,1-2H3;1H/p-1.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride?
1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride has a molecular weight of 140.18 g/mol, XLogP of -1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylmethanamine fluoride is sourced from PubChem (CID 139243611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).