C15H20F3NO — CID 139243632
1,2,2,3-tetramethyl-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline (PubChem CID 139243632) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline.
| Compound Name | 1,2,2,3-tetramethyl-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 139243632 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1,2,2,3-tetramethyl-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline |
| SMILES | CC1C(OCC(F)(F)F)c2ccccc2N(C)C1(C)C |
| InChI | InChI=1S/C15H20F3NO/c1-10-13(20-9-15(16,17)18)11-7-5-6-8-12(11)19(4)14(10,2)3/h5-8,10,13H,9H2,1-4H3 |
| InChIKey | YCHFQVYVVYDRQB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |