About 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate
2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate (PubChem CID 139243816) has the molecular formula C9H13F3N2O4
and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate |
| PubChem CID | 139243816 |
| Molecular Formula | C9H13F3N2O4 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.OCCn1cc[n+](CCO)c1 |
| InChI | InChI=1S/C7H13N2O2.C2HF3O2/c10-5-3-8-1-2-9(7-8)4-6-11;3-2(4,5)1(6)7/h1-2,7,10-11H,3-6H2;(H,6,7)/q+1;/p-1 |
| InChIKey | MKOOWVFEXDUOIE-UHFFFAOYSA-M |
| XLogP | -1.94 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate?
The IUPAC name of 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate (CID 139243816) is 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate.
What is the SMILES notation for 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate?
The canonical SMILES for 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate is O=C([O-])C(F)(F)F.OCCn1cc[n+](CCO)c1.
What is the InChIKey of 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate?
The InChIKey is MKOOWVFEXDUOIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13N2O2.C2HF3O2/c10-5-3-8-1-2-9(7-8)4-6-11;3-2(4,5)1(6)7/h1-2,7,10-11H,3-6H2;(H,6,7)/q+1;/p-1.
What are the key properties of 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate?
2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate has a molecular weight of 270.21 g/mol, XLogP of -1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-hydroxyethyl)imidazol-3-ium-1-yl]ethanol;2,2,2-trifluoroacetate is sourced from PubChem (CID 139243816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).