About (E)-4-bromo-2,4-dinitropent-2-ene
(E)-4-bromo-2,4-dinitropent-2-ene (PubChem CID 139243881) has the molecular formula C5H7BrN2O4
and a molecular weight of 239.02 g/mol. Its IUPAC name is (E)-4-bromo-2,4-dinitropent-2-ene.
Molecular Properties
| Compound Name | (E)-4-bromo-2,4-dinitropent-2-ene |
| PubChem CID | 139243881 |
| Molecular Formula | C5H7BrN2O4 |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | (E)-4-bromo-2,4-dinitropent-2-ene |
| SMILES | C/C(=C\C(C)(Br)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H7BrN2O4/c1-4(7(9)10)3-5(2,6)8(11)12/h3H,1-2H3/b4-3+ |
| InChIKey | VEUJZEUISIWPOW-ONEGZZNKSA-N |
| XLogP | 1.55 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-bromo-2,4-dinitropent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-bromo-2,4-dinitropent-2-ene?
The IUPAC name of (E)-4-bromo-2,4-dinitropent-2-ene (CID 139243881) is (E)-4-bromo-2,4-dinitropent-2-ene.
What is the SMILES notation for (E)-4-bromo-2,4-dinitropent-2-ene?
The canonical SMILES for (E)-4-bromo-2,4-dinitropent-2-ene is C/C(=C\C(C)(Br)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of (E)-4-bromo-2,4-dinitropent-2-ene?
The InChIKey is VEUJZEUISIWPOW-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H7BrN2O4/c1-4(7(9)10)3-5(2,6)8(11)12/h3H,1-2H3/b4-3+.
What are the key properties of (E)-4-bromo-2,4-dinitropent-2-ene?
(E)-4-bromo-2,4-dinitropent-2-ene has a molecular weight of 239.02 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-bromo-2,4-dinitropent-2-ene is sourced from PubChem (CID 139243881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).