C37H35NO2 — CID 139244182
[16-benzoyl-8-[[di(propan-2-yl)amino]methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]-phenylmethanone (PubChem CID 139244182) has the molecular formula C37H35NO2 and a molecular weight of 525.69 g/mol. Its IUPAC name is [16-benzoyl-8-[[di(propan-2-yl)amino]methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]-phenylmethanone.
| Compound Name | [16-benzoyl-8-[[di(propan-2-yl)amino]methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]-phenylmethanone |
|---|---|
| PubChem CID | 139244182 |
| Molecular Formula | C37H35NO2 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [16-benzoyl-8-[[di(propan-2-yl)amino]methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]-phenylmethanone |
| SMILES | CC(C)N(CC12C(C(=O)c3ccccc3)=C(C(=O)c3ccccc3)C(c3ccccc31)c1ccccc12)C(C)C |
| InChI | InChI=1S/C37H35NO2/c1-24(2)38(25(3)4)23-37-30-21-13-11-19-28(30)32(29-20-12-14-22-31(29)37)33(35(39)26-15-7-5-8-16-26)34(37)36(40)27-17-9-6-10-18-27/h5-22,24-25,32H,23H2,1-4H3 |
| InChIKey | PAAYGIMDNMMKJV-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |