About CID 139244331
CID 139244331 (PubChem CID 139244331) has the molecular formula C12H24N3O2
and a molecular weight of 242.34 g/mol.
Molecular Properties
| Compound Name | CID 139244331 |
| PubChem CID | 139244331 |
| Molecular Formula | C12H24N3O2 |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C12H24N3O2/c1-11(2)7-9(13-10(16)14(5)6)8-12(3,4)15(11)17/h9H,7-8H2,1-6H3,(H,13,16) |
| InChIKey | DFDHMFCPQVURMZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 139244331 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139244331?
The IUPAC name of CID 139244331 (CID 139244331) is not available.
What is the SMILES notation for CID 139244331?
The canonical SMILES for CID 139244331 is CN(C)C(=O)NC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 139244331?
The InChIKey is DFDHMFCPQVURMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N3O2/c1-11(2)7-9(13-10(16)14(5)6)8-12(3,4)15(11)17/h9H,7-8H2,1-6H3,(H,13,16).
What are the key properties of CID 139244331?
CID 139244331 has a molecular weight of 242.34 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139244331 is sourced from PubChem (CID 139244331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).