C20H19N4O4P — CID 139244412
[2-(3-methyl-1H-imidazol-3-ium-2-yl)phenyl] [2-(1-methylimidazol-2-yl)phenyl] phosphate (PubChem CID 139244412) has the molecular formula C20H19N4O4P and a molecular weight of 410.37 g/mol. Its IUPAC name is [2-(3-methyl-1H-imidazol-3-ium-2-yl)phenyl] [2-(1-methylimidazol-2-yl)phenyl] phosphate.
| Compound Name | [2-(3-methyl-1H-imidazol-3-ium-2-yl)phenyl] [2-(1-methylimidazol-2-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 139244412 |
| Molecular Formula | C20H19N4O4P |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [2-(3-methyl-1H-imidazol-3-ium-2-yl)phenyl] [2-(1-methylimidazol-2-yl)phenyl] phosphate |
| SMILES | Cn1ccnc1-c1ccccc1OP(=O)([O-])Oc1ccccc1-c1[nH]cc[n+]1C |
| InChI | InChI=1S/C20H19N4O4P/c1-23-13-11-21-19(23)15-7-3-5-9-17(15)27-29(25,26)28-18-10-6-4-8-16(18)20-22-12-14-24(20)2/h3-14H,1-2H3,(H,25,26) |
| InChIKey | FYWPCJBSSKBQMI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|