C9H17NO3 — CID 139244713
1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one (PubChem CID 139244713) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 139244713 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)[N+]1([O-])O |
| InChI | InChI=1S/C9H17NO3/c1-8(2)5-7(11)6-9(3,4)10(8,12)13/h12H,5-6H2,1-4H3 |
| InChIKey | FBOCAVQTBPHUFP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|