C17H14Br2N2 — CID 139244815
3,5-bis(3-bromophenyl)-4,4-dimethylpyrazole (PubChem CID 139244815) has the molecular formula C17H14Br2N2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 3,5-bis(3-bromophenyl)-4,4-dimethylpyrazole.
| Compound Name | 3,5-bis(3-bromophenyl)-4,4-dimethylpyrazole |
|---|---|
| PubChem CID | 139244815 |
| Molecular Formula | C17H14Br2N2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 3,5-bis(3-bromophenyl)-4,4-dimethylpyrazole |
| SMILES | CC1(C)C(c2cccc(Br)c2)=NN=C1c1cccc(Br)c1 |
| InChI | InChI=1S/C17H14Br2N2/c1-17(2)15(11-5-3-7-13(18)9-11)20-21-16(17)12-6-4-8-14(19)10-12/h3-10H,1-2H3 |
| InChIKey | DWXOUECVLOSGEK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |