About CID 139244827
CID 139244827 (PubChem CID 139244827) has the molecular formula C11H14N2Si
and a molecular weight of 202.33 g/mol.
Molecular Properties
| Compound Name | CID 139244827 |
|---|
| PubChem CID | 139244827 |
|---|
| Molecular Formula | C11H14N2Si |
|---|
| Molecular Weight | 202.33 g/mol |
|---|
| Exact Mass | 202.09 |
|---|
| IUPAC Name | — |
|---|
| SMILES | CN1C=CN(C)C1[Si]c1ccccc1 |
|---|
| InChI | InChI=1S/C11H14N2Si/c1-12-8-9-13(2)11(12)14-10-6-4-3-5-7-10/h3-9,11H,1-2H3 |
|---|
| InChIKey | FYCAXQDDFHFUCZ-UHFFFAOYSA-N |
|---|
| XLogP | 0.65 |
|---|
| TPSA | 6.48 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 14 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139244827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139244827?
The IUPAC name of CID 139244827 (CID 139244827) is not available.
What is the SMILES notation for CID 139244827?
The canonical SMILES for CID 139244827 is CN1C=CN(C)C1[Si]c1ccccc1.
What is the InChIKey of CID 139244827?
The InChIKey is FYCAXQDDFHFUCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2Si/c1-12-8-9-13(2)11(12)14-10-6-4-3-5-7-10/h3-9,11H,1-2H3.
What are the key properties of CID 139244827?
CID 139244827 has a molecular weight of 202.33 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139244827 is sourced from PubChem (CID 139244827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).