About CID 139244876
CID 139244876 (PubChem CID 139244876) has the molecular formula C35H30Br2Cl4N2
and a molecular weight of 780.26 g/mol.
Molecular Properties
| Compound Name | CID 139244876 |
| PubChem CID | 139244876 |
| Molecular Formula | C35H30Br2Cl4N2 |
| Molecular Weight | 780.26 g/mol |
| Exact Mass | 775.95 |
| IUPAC Name | — |
| SMILES | CCCC[n+]1c2cccc(Cl)c2c([C]c2c3c(Cl)cccc3[n+](CCCC)c3cccc(Cl)c23)c2c(Cl)cccc21.[Br-].[Br-] |
| InChI | InChI=1S/C35H30Cl4N2.2BrH/c1-3-5-19-40-28-15-7-11-24(36)32(28)22(33-25(37)12-8-16-29(33)40)21-23-34-26(38)13-9-17-30(34)41(20-6-4-2)31-18-10-14-27(39)35(23)31;;/h7-18H,3-6,19-20H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | JUUAGXVBEGHCPG-UHFFFAOYSA-L |
| XLogP | 4.57 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 780.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 139244876 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139244876?
The IUPAC name of CID 139244876 (CID 139244876) is not available.
What is the SMILES notation for CID 139244876?
The canonical SMILES for CID 139244876 is CCCC[n+]1c2cccc(Cl)c2c([C]c2c3c(Cl)cccc3[n+](CCCC)c3cccc(Cl)c23)c2c(Cl)cccc21.[Br-].[Br-].
What is the InChIKey of CID 139244876?
The InChIKey is JUUAGXVBEGHCPG-UHFFFAOYSA-L. The full InChI is InChI=1S/C35H30Cl4N2.2BrH/c1-3-5-19-40-28-15-7-11-24(36)32(28)22(33-25(37)12-8-16-29(33)40)21-23-34-26(38)13-9-17-30(34)41(20-6-4-2)31-18-10-14-27(39)35(23)31;;/h7-18H,3-6,19-20H2,1-2H3;2*1H/q+2;;/p-2.
What are the key properties of CID 139244876?
CID 139244876 has a molecular weight of 780.26 g/mol, XLogP of 4.57, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139244876 is sourced from PubChem (CID 139244876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).