About 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane
1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane (PubChem CID 139244924) has the molecular formula C5H4F8O4S2
and a molecular weight of 344.20 g/mol. Its IUPAC name is 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane.
Molecular Properties
| Compound Name | 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane |
| PubChem CID | 139244924 |
| Molecular Formula | C5H4F8O4S2 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane |
| SMILES | O=S(=O)(C(CC(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F8O4S2/c6-2(7)1-3(18(14,15)4(8,9)10)19(16,17)5(11,12)13/h2-3H,1H2 |
| InChIKey | RDBUKHRJCIZJPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane?
The IUPAC name of 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane (CID 139244924) is 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane.
What is the SMILES notation for 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane?
The canonical SMILES for 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane is O=S(=O)(C(CC(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane?
The InChIKey is RDBUKHRJCIZJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F8O4S2/c6-2(7)1-3(18(14,15)4(8,9)10)19(16,17)5(11,12)13/h2-3H,1H2.
What are the key properties of 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane?
1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane has a molecular weight of 344.20 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-3,3-bis(trifluoromethylsulfonyl)propane is sourced from PubChem (CID 139244924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).