C6H5F9O4S2 — CID 139244934
1,1,1-trifluoro-4,4-bis(trifluoromethylsulfonyl)butane (PubChem CID 139244934) has the molecular formula C6H5F9O4S2 and a molecular weight of 376.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-4,4-bis(trifluoromethylsulfonyl)butane.
| Compound Name | 1,1,1-trifluoro-4,4-bis(trifluoromethylsulfonyl)butane |
|---|---|
| PubChem CID | 139244934 |
| Molecular Formula | C6H5F9O4S2 |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 1,1,1-trifluoro-4,4-bis(trifluoromethylsulfonyl)butane |
| SMILES | O=S(=O)(C(CCC(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9O4S2/c7-4(8,9)2-1-3(20(16,17)5(10,11)12)21(18,19)6(13,14)15/h3H,1-2H2 |
| InChIKey | SDBSDSREVPZCAZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |