C10H7BBr2F3N2O- — CID 139244988
[3,5-dibromo-2-(pent-4-ynoylamino)-4-pyridinyl]-trifluoroboranuide (PubChem CID 139244988) has the molecular formula C10H7BBr2F3N2O- and a molecular weight of 398.79 g/mol. Its IUPAC name is [3,5-dibromo-2-(pent-4-ynoylamino)-4-pyridinyl]-trifluoroboranuide.
| Compound Name | [3,5-dibromo-2-(pent-4-ynoylamino)-4-pyridinyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 139244988 |
| Molecular Formula | C10H7BBr2F3N2O- |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | [3,5-dibromo-2-(pent-4-ynoylamino)-4-pyridinyl]-trifluoroboranuide |
| SMILES | C#CCCC(=O)Nc1ncc(Br)c([B-](F)(F)F)c1Br |
| InChI | InChI=1S/C10H7BBr2F3N2O/c1-2-3-4-7(19)18-10-9(13)8(11(14,15)16)6(12)5-17-10/h1,5H,3-4H2,(H,17,18,19)/q-1 |
| InChIKey | IODXBHQWRWBSRL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|