C14H10N2 — CID 139244999
1,8-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,9,11,13,15-heptaene (PubChem CID 139244999) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1,8-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,9,11,13,15-heptaene.
| Compound Name | 1,8-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 139244999 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1,8-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,9,11,13,15-heptaene |
| SMILES | c1cc2ccn3cccc4ccn(c1)c2=c43 |
| InChI | InChI=1S/C14H10N2/c1-3-11-5-10-16-8-2-4-12-6-9-15(7-1)13(11)14(12)16/h1-10H |
| InChIKey | MZWOUXOHVSRVSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |