C30H30BF2N3O2 — CID 139245177
methyl 4-[12-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-4,6,10-trimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate (PubChem CID 139245177) has the molecular formula C30H30BF2N3O2 and a molecular weight of 513.40 g/mol. Its IUPAC name is methyl 4-[12-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-4,6,10-trimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate.
| Compound Name | methyl 4-[12-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-4,6,10-trimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate |
|---|---|
| PubChem CID | 139245177 |
| Molecular Formula | C30H30BF2N3O2 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | methyl 4-[12-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,2-difluoro-4,6,10-trimethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2=C3C(C)=CC(/C=C/c4ccc(N(C)C)cc4)=[N+]3[B-](F)(F)n3c(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C30H30BF2N3O2/c1-19-17-21(3)35-28(19)27(23-10-12-24(13-11-23)30(37)38-6)29-20(2)18-26(36(29)31(35,32)33)16-9-22-7-14-25(15-8-22)34(4)5/h7-18H,1-6H3/b16-9+ |
| InChIKey | KGUXTFADLRCSTJ-CXUHLZMHSA-N |
| XLogP | 6.08 |
| TPSA | 37.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|