About CID 139245275
CID 139245275 (PubChem CID 139245275) has the molecular formula C8H9O6
and a molecular weight of 201.15 g/mol.
Molecular Properties
| Compound Name | CID 139245275 |
| PubChem CID | 139245275 |
| Molecular Formula | C8H9O6 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C(O)C(O[O])C(O)C=C1 |
| InChI | InChI=1S/C8H9O6/c1-13-8(11)4-2-3-5(9)7(14-12)6(4)10/h2-3,5,7,9-10H,1H3 |
| InChIKey | PHCWZFSKBRMVCB-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 139245275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139245275?
The IUPAC name of CID 139245275 (CID 139245275) is not available.
What is the SMILES notation for CID 139245275?
The canonical SMILES for CID 139245275 is COC(=O)C1=C(O)C(O[O])C(O)C=C1.
What is the InChIKey of CID 139245275?
The InChIKey is PHCWZFSKBRMVCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O6/c1-13-8(11)4-2-3-5(9)7(14-12)6(4)10/h2-3,5,7,9-10H,1H3.
What are the key properties of CID 139245275?
CID 139245275 has a molecular weight of 201.15 g/mol, XLogP of -0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139245275 is sourced from PubChem (CID 139245275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).