About CID 139245380
CID 139245380 (PubChem CID 139245380) has the molecular formula C6H10N3O3
and a molecular weight of 172.16 g/mol.
Molecular Properties
| Compound Name | CID 139245380 |
| PubChem CID | 139245380 |
| Molecular Formula | C6H10N3O3 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | — |
| SMILES | CC(=O)NC([CH]C(N)=O)C(N)=O |
| InChI | InChI=1S/C6H10N3O3/c1-3(10)9-4(6(8)12)2-5(7)11/h2,4H,1H3,(H2,7,11)(H2,8,12)(H,9,10) |
| InChIKey | WMPKZTOZKMWCRI-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 139245380 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139245380?
The IUPAC name of CID 139245380 (CID 139245380) is not available.
What is the SMILES notation for CID 139245380?
The canonical SMILES for CID 139245380 is CC(=O)NC([CH]C(N)=O)C(N)=O.
What is the InChIKey of CID 139245380?
The InChIKey is WMPKZTOZKMWCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N3O3/c1-3(10)9-4(6(8)12)2-5(7)11/h2,4H,1H3,(H2,7,11)(H2,8,12)(H,9,10).
What are the key properties of CID 139245380?
CID 139245380 has a molecular weight of 172.16 g/mol, XLogP of -2.33, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139245380 is sourced from PubChem (CID 139245380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).