C10H6F8 — CID 139245537
1-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzene (PubChem CID 139245537) has the molecular formula C10H6F8 and a molecular weight of 278.14 g/mol. Its IUPAC name is 1-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139245537 |
| Molecular Formula | C10H6F8 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-(2,2,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F8/c11-8(12,10(16,17)18)5-6-2-1-3-7(4-6)9(13,14)15/h1-4H,5H2 |
| InChIKey | YTTDBMPLSYSQRU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|