About CID 139245904
CID 139245904 (PubChem CID 139245904) has the molecular formula C6H4ClS
and a molecular weight of 143.62 g/mol.
Molecular Properties
| Compound Name | CID 139245904 |
| PubChem CID | 139245904 |
| Molecular Formula | C6H4ClS |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 142.97 |
| IUPAC Name | — |
| SMILES | [S]c1cccc(Cl)c1 |
| InChI | InChI=1S/C6H4ClS/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | VCZGDGNIJKJUNI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 139245904 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139245904?
The IUPAC name of CID 139245904 (CID 139245904) is not available.
What is the SMILES notation for CID 139245904?
The canonical SMILES for CID 139245904 is [S]c1cccc(Cl)c1.
What is the InChIKey of CID 139245904?
The InChIKey is VCZGDGNIJKJUNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClS/c7-5-2-1-3-6(8)4-5/h1-4H.
What are the key properties of CID 139245904?
CID 139245904 has a molecular weight of 143.62 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139245904 is sourced from PubChem (CID 139245904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).