C40H33ClN2O6 — CID 139246044
dipropan-2-yl 5-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate (PubChem CID 139246044) has the molecular formula C40H33ClN2O6 and a molecular weight of 673.17 g/mol. Its IUPAC name is dipropan-2-yl 5-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139246044 |
| Molecular Formula | C40H33ClN2O6 |
| Molecular Weight | 673.17 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | dipropan-2-yl 5-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)C1=C(C(=O)OC(C)C)C2(c3ccccc3-c3ccccc32)C2C=C(/C=C/c3ccc(Cl)c([N+](=O)[O-])c3)c3ccccc3N12 |
| InChI | InChI=1S/C40H33ClN2O6/c1-23(2)48-38(44)36-37(39(45)49-24(3)4)42-33-16-10-7-11-27(33)26(19-17-25-18-20-32(41)34(21-25)43(46)47)22-35(42)40(36)30-14-8-5-12-28(30)29-13-6-9-15-31(29)40/h5-24,35H,1-4H3/b19-17+ |
| InChIKey | VTTGVYTUSVHKET-HTXNQAPBSA-N |
| XLogP | 8.67 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.17 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|