C40H34N2O6 — CID 139246045
dipropan-2-yl 5-[(E)-2-(3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate (PubChem CID 139246045) has the molecular formula C40H34N2O6 and a molecular weight of 638.72 g/mol. Its IUPAC name is dipropan-2-yl 5-[(E)-2-(3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[(E)-2-(3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139246045 |
| Molecular Formula | C40H34N2O6 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | dipropan-2-yl 5-[(E)-2-(3-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)C1=C(C(=O)OC(C)C)C2(c3ccccc3-c3ccccc32)C2C=C(/C=C/c3cccc([N+](=O)[O-])c3)c3ccccc3N12 |
| InChI | InChI=1S/C40H34N2O6/c1-24(2)47-38(43)36-37(39(44)48-25(3)4)41-34-19-10-7-14-29(34)27(21-20-26-12-11-13-28(22-26)42(45)46)23-35(41)40(36)32-17-8-5-15-30(32)31-16-6-9-18-33(31)40/h5-25,35H,1-4H3/b21-20+ |
| InChIKey | MQDSOGMGROVWST-QZQOTICOSA-N |
| XLogP | 8.02 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|