C38H28N2O8 — CID 139246135
trimethyl 5-[(E)-2-(2-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2,4'-tricarboxylate (PubChem CID 139246135) has the molecular formula C38H28N2O8 and a molecular weight of 640.65 g/mol. Its IUPAC name is trimethyl 5-[(E)-2-(2-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2,4'-tricarboxylate.
| Compound Name | trimethyl 5-[(E)-2-(2-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2,4'-tricarboxylate |
|---|---|
| PubChem CID | 139246135 |
| Molecular Formula | C38H28N2O8 |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | trimethyl 5-[(E)-2-(2-nitrophenyl)ethenyl]spiro[3aH-pyrrolo[1,2-a]quinoline-3,9'-fluorene]-1,2,4'-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(c3ccccc3-c3c(C(=O)OC)cccc32)C2C=C(/C=C/c3ccccc3[N+](=O)[O-])c3ccccc3N12 |
| InChI | InChI=1S/C38H28N2O8/c1-46-35(41)26-14-10-16-28-32(26)25-13-5-7-15-27(25)38(28)31-21-23(20-19-22-11-4-8-17-29(22)40(44)45)24-12-6-9-18-30(24)39(31)34(37(43)48-3)33(38)36(42)47-2/h4-21,31H,1-3H3/b20-19+ |
| InChIKey | FWFZZWYQBNIJGU-FMQUCBEESA-N |
| XLogP | 6.25 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|