C16H11O5- — CID 139246404
3-methyl-10'-oxospiro[1,2,4-trioxolane-5,9'-anthracene]-3-olate (PubChem CID 139246404) has the molecular formula C16H11O5- and a molecular weight of 283.26 g/mol. Its IUPAC name is 3-methyl-10'-oxospiro[1,2,4-trioxolane-5,9'-anthracene]-3-olate.
| Compound Name | 3-methyl-10'-oxospiro[1,2,4-trioxolane-5,9'-anthracene]-3-olate |
|---|---|
| PubChem CID | 139246404 |
| Molecular Formula | C16H11O5- |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-methyl-10'-oxospiro[1,2,4-trioxolane-5,9'-anthracene]-3-olate |
| SMILES | CC1([O-])OOC2(O1)c1ccccc1C(=O)c1ccccc12 |
| InChI | InChI=1S/C16H11O5/c1-15(18)19-16(21-20-15)12-8-4-2-6-10(12)14(17)11-7-3-5-9-13(11)16/h2-9H,1H3/q-1 |
| InChIKey | OUGVAVASBWPKNJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|