About (3,5-diazidophenyl)methyl methanesulfonate
(3,5-diazidophenyl)methyl methanesulfonate (PubChem CID 139246409) has the molecular formula C8H8N6O3S
and a molecular weight of 268.26 g/mol. Its IUPAC name is (3,5-diazidophenyl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (3,5-diazidophenyl)methyl methanesulfonate |
| PubChem CID | 139246409 |
| Molecular Formula | C8H8N6O3S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (3,5-diazidophenyl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cc(N=[N+]=[N-])cc(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C8H8N6O3S/c1-18(15,16)17-5-6-2-7(11-13-9)4-8(3-6)12-14-10/h2-4H,5H2,1H3 |
| InChIKey | VTIJDNGWPGLCTN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 140.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-diazidophenyl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-diazidophenyl)methyl methanesulfonate?
The IUPAC name of (3,5-diazidophenyl)methyl methanesulfonate (CID 139246409) is (3,5-diazidophenyl)methyl methanesulfonate.
What is the SMILES notation for (3,5-diazidophenyl)methyl methanesulfonate?
The canonical SMILES for (3,5-diazidophenyl)methyl methanesulfonate is CS(=O)(=O)OCc1cc(N=[N+]=[N-])cc(N=[N+]=[N-])c1.
What is the InChIKey of (3,5-diazidophenyl)methyl methanesulfonate?
The InChIKey is VTIJDNGWPGLCTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O3S/c1-18(15,16)17-5-6-2-7(11-13-9)4-8(3-6)12-14-10/h2-4H,5H2,1H3.
What are the key properties of (3,5-diazidophenyl)methyl methanesulfonate?
(3,5-diazidophenyl)methyl methanesulfonate has a molecular weight of 268.26 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-diazidophenyl)methyl methanesulfonate is sourced from PubChem (CID 139246409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).